Oxazolo[5,4-c]pyridine, 4-chloro-2-Methyl- - Names and Identifiers
Name | 4-chloro-2-methyl-oxazolo[5,4-c]pyridine
|
Synonyms | 4-Chloro-2-methyloxazolo[5,4-c]pyridine 4-chloro-2-methyl-oxazolo[5,4-c]pyridine Oxazolo[5,4-c]pyridine, 4-chloro-2-Methyl- Oxazolo[5,4-c]pyridine, 4-chloro-2-methyl- 4-Chloro-2-methyl[1,3]oxazolo[5,4-c]pyridine
|
CAS | 1354831-15-4
|
InChI | InChI=1S/C7H5ClN2O/c1-4-10-5-2-3-9-7(8)6(5)11-4/h2-3H,1H3 |
Oxazolo[5,4-c]pyridine, 4-chloro-2-Methyl- - Physico-chemical Properties
Molecular Formula | C7H5ClN2O
|
Molar Mass | 168.58 |
Storage Condition | Room Temprature |
Oxazolo[5,4-c]pyridine, 4-chloro-2-Methyl- - Introduction
2-Methyl-4-chloro-oxazolo [5,4-c] pyridine is an organic compound with the chemical formula C9H6ClNO and a molecular weight of 181.6g/mol.
This compound has the following properties:
1. Appearance: White to light yellow crystalline powder.
2. Melting point: about 175-180°C.
3. Solubility: It is soluble in most organic solvents, such as dichloromethane, acetone and methanol, but almost insoluble in water.
2-Methyl-4-chloro-oxazolo [5,4-c] pyridine can be used in the field of organic synthesis, commonly used as pesticides, fungicides, light stabilizers and pharmaceutical intermediates. It has a broad spectrum of bacteriostatic activity and can be used to prevent plant diseases and pests.
The compound can be obtained by the following synthesis method:
1. Condensation of 4-mercapto oxazole with 2-methyl acetone under alkaline conditions to obtain 2-methyl -4-mercapto -5-methyl oxazole;
2. reacting 2-methyl-4-mercapto-5-methyloxazole with chloride sulfate to obtain 2-methyl-4-chloro-5-methyloxazole;
3. Finally, 2-methyl -4-chloro -5-methyloxazole is converted into 2-methyl -4-chloro-oxazolo [5,4-c] pyridine through oxidation, dehydration and other reactions.
Regarding safety information, due to the different hazards of chemicals and the use environment, specific safety information needs to refer to the relevant Material Safety Data Sheet (MSDS) or obtain from a reliable chemical supplier. When using the compound, follow proper laboratory practices, wear appropriate personal protective equipment, and store and dispose of the compound to avoid harm to humans and the environment.
Last Update:2024-04-09 21:04:16